C38H54N4O7 — CID 54109783
[(1S,2R)-1-[[(2R,4S,5S)-2-benzyl-6-cyclohexyl-4-hydroxy-5-[[(3S)-oxolan-3-yl]oxycarbonylamino]hexanoyl]amino]-2,3-dihydro-1H-inden-2-yl] (2S)-2,5-diaminopentanoate (PubChem CID 54109783) has the molecular formula C38H54N4O7 and a molecular weight of 678.87 g/mol. Its IUPAC name is [(1S,2R)-1-[[(2R,4S,5S)-2-benzyl-6-cyclohexyl-4-hydroxy-5-[[(3S)-oxolan-3-yl]oxycarbonylamino]hexanoyl]amino]-2,3-dihydro-1H-inden-2-yl] (2S)-2,5-diaminopentanoate.
| Compound Name | [(1S,2R)-1-[[(2R,4S,5S)-2-benzyl-6-cyclohexyl-4-hydroxy-5-[[(3S)-oxolan-3-yl]oxycarbonylamino]hexanoyl]amino]-2,3-dihydro-1H-inden-2-yl] (2S)-2,5-diaminopentanoate |
|---|---|
| PubChem CID | 54109783 |
| Molecular Formula | C38H54N4O7 |
| Molecular Weight | 678.87 g/mol |
| Exact Mass | 678.40 |
| IUPAC Name | [(1S,2R)-1-[[(2R,4S,5S)-2-benzyl-6-cyclohexyl-4-hydroxy-5-[[(3S)-oxolan-3-yl]oxycarbonylamino]hexanoyl]amino]-2,3-dihydro-1H-inden-2-yl] (2S)-2,5-diaminopentanoate |
| SMILES | NCCC[C@H](N)C(=O)O[C@@H]1Cc2ccccc2[C@@H]1NC(=O)[C@H](Cc1ccccc1)C[C@H](O)[C@H](CC1CCCCC1)NC(=O)O[C@H]1CCOC1 |
| InChI | InChI=1S/C38H54N4O7/c39-18-9-16-31(40)37(45)49-34-23-27-14-7-8-15-30(27)35(34)42-36(44)28(20-25-10-3-1-4-11-25)22-33(43)32(21-26-12-5-2-6-13-26)41-38(46)48-29-17-19-47-24-29/h1,3-4,7-8,10-11,14-15,26,28-29,31-35,43H,2,5-6,9,12-13,16-24,39-40H2,(H,41,46)(H,42,44)/t28-,29+,31+,32+,33+,34-,35+/m1/s1 |
| InChIKey | NGGWISIECVAUKK-ZUVZQTODSA-N |
| XLogP | 3.84 |
| TPSA | 175.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |