C35H51N2O10P — CID 70059609
tert-butyl N-[(2S,3S,5R)-1-cyclohexyl-3-hydroxy-6-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-6-oxo-5-[[4-(2-phosphonooxyethoxy)phenyl]methyl]hexan-2-yl]carbamate (PubChem CID 70059609) has the molecular formula C35H51N2O10P and a molecular weight of 690.77 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,5R)-1-cyclohexyl-3-hydroxy-6-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-6-oxo-5-[[4-(2-phosphonooxyethoxy)phenyl]methyl]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,5R)-1-cyclohexyl-3-hydroxy-6-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-6-oxo-5-[[4-(2-phosphonooxyethoxy)phenyl]methyl]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 70059609 |
| Molecular Formula | C35H51N2O10P |
| Molecular Weight | 690.77 g/mol |
| Exact Mass | 690.33 |
| IUPAC Name | tert-butyl N-[(2S,3S,5R)-1-cyclohexyl-3-hydroxy-6-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-6-oxo-5-[[4-(2-phosphonooxyethoxy)phenyl]methyl]hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1CCCCC1)[C@@H](O)C[C@@H](Cc1ccc(OCCOP(=O)(O)O)cc1)C(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C35H51N2O10P/c1-35(2,3)47-34(41)36-29(20-23-9-5-4-6-10-23)30(38)22-26(33(40)37-32-28-12-8-7-11-25(28)21-31(32)39)19-24-13-15-27(16-14-24)45-17-18-46-48(42,43)44/h7-8,11-16,23,26,29-32,38-39H,4-6,9-10,17-22H2,1-3H3,(H,36,41)(H,37,40)(H2,42,43,44)/t26-,29+,30+,31-,32+/m1/s1 |
| InChIKey | XFONFXMQCZKBSN-KHQGQIEXSA-N |
| XLogP | 4.72 |
| TPSA | 183.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.77 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|