C39H51N3O6 — CID 70056685
tert-butyl N-[(2S,3S,5R)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-3-hydroxy-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]-8-phenyloct-7-en-2-yl]carbamate (PubChem CID 70056685) has the molecular formula C39H51N3O6 and a molecular weight of 657.85 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,5R)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-3-hydroxy-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]-8-phenyloct-7-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,5R)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-3-hydroxy-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]-8-phenyloct-7-en-2-yl]carbamate |
|---|---|
| PubChem CID | 70056685 |
| Molecular Formula | C39H51N3O6 |
| Molecular Weight | 657.85 g/mol |
| Exact Mass | 657.38 |
| IUPAC Name | tert-butyl N-[(2S,3S,5R)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-3-hydroxy-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]-8-phenyloct-7-en-2-yl]carbamate |
| SMILES | CN(C)CCOc1ccc(C[C@H](NC(=O)OC(C)(C)C)[C@@H](O)C[C@@H](CC=Cc2ccccc2)C(=O)N[C@H]2c3ccccc3C[C@H]2O)cc1 |
| InChI | InChI=1S/C39H51N3O6/c1-39(2,3)48-38(46)40-33(24-28-18-20-31(21-19-28)47-23-22-42(4)5)34(43)26-30(16-11-14-27-12-7-6-8-13-27)37(45)41-36-32-17-10-9-15-29(32)25-35(36)44/h6-15,17-21,30,33-36,43-44H,16,22-26H2,1-5H3,(H,40,46)(H,41,45)/t30-,33+,34+,35-,36+/m1/s1 |
| InChIKey | JUINZGMXKFGMFT-AIIVFDHXSA-N |
| XLogP | 5.31 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.85 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |