About 1-iodo-4-methylazulene
1-iodo-4-methylazulene (PubChem CID 139618085) has the molecular formula C11H9I
and a molecular weight of 268.10 g/mol. Its IUPAC name is 1-iodo-4-methylazulene.
Molecular Properties
| Compound Name | 1-iodo-4-methylazulene |
| PubChem CID | 139618085 |
| Molecular Formula | C11H9I |
| Molecular Weight | 268.10 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 1-iodo-4-methylazulene |
| SMILES | Cc1ccccc2c(I)ccc1-2 |
| InChI | InChI=1S/C11H9I/c1-8-4-2-3-5-10-9(8)6-7-11(10)12/h2-7H,1H3 |
| InChIKey | JBKAMQVBSVHXJC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.10 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-4-methylazulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-4-methylazulene?
The IUPAC name of 1-iodo-4-methylazulene (CID 139618085) is 1-iodo-4-methylazulene.
What is the SMILES notation for 1-iodo-4-methylazulene?
The canonical SMILES for 1-iodo-4-methylazulene is Cc1ccccc2c(I)ccc1-2.
What is the InChIKey of 1-iodo-4-methylazulene?
The InChIKey is JBKAMQVBSVHXJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9I/c1-8-4-2-3-5-10-9(8)6-7-11(10)12/h2-7H,1H3.
What are the key properties of 1-iodo-4-methylazulene?
1-iodo-4-methylazulene has a molecular weight of 268.10 g/mol, XLogP of 3.70, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-4-methylazulene is sourced from PubChem (CID 139618085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).