About propan-2-yl N-hex-1-en-3-ylcarbamate
propan-2-yl N-hex-1-en-3-ylcarbamate (PubChem CID 139619222) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is propan-2-yl N-hex-1-en-3-ylcarbamate.
Molecular Properties
| Compound Name | propan-2-yl N-hex-1-en-3-ylcarbamate |
| PubChem CID | 139619222 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | propan-2-yl N-hex-1-en-3-ylcarbamate |
| SMILES | C=CC(CCC)NC(=O)OC(C)C |
| InChI | InChI=1S/C10H19NO2/c1-5-7-9(6-2)11-10(12)13-8(3)4/h6,8-9H,2,5,7H2,1,3-4H3,(H,11,12) |
| InChIKey | WBTAOFFHPXTJHW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-hex-1-en-3-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-hex-1-en-3-ylcarbamate?
The IUPAC name of propan-2-yl N-hex-1-en-3-ylcarbamate (CID 139619222) is propan-2-yl N-hex-1-en-3-ylcarbamate.
What is the SMILES notation for propan-2-yl N-hex-1-en-3-ylcarbamate?
The canonical SMILES for propan-2-yl N-hex-1-en-3-ylcarbamate is C=CC(CCC)NC(=O)OC(C)C.
What is the InChIKey of propan-2-yl N-hex-1-en-3-ylcarbamate?
The InChIKey is WBTAOFFHPXTJHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-5-7-9(6-2)11-10(12)13-8(3)4/h6,8-9H,2,5,7H2,1,3-4H3,(H,11,12).
What are the key properties of propan-2-yl N-hex-1-en-3-ylcarbamate?
propan-2-yl N-hex-1-en-3-ylcarbamate has a molecular weight of 185.27 g/mol, XLogP of 2.48, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-hex-1-en-3-ylcarbamate is sourced from PubChem (CID 139619222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).