C18H19N3O4 — CID 139620580
5-[3-hydroxy-6-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-2-yl]pentanoic acid (PubChem CID 139620580) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 5-[3-hydroxy-6-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-2-yl]pentanoic acid.
| Compound Name | 5-[3-hydroxy-6-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 139620580 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 5-[3-hydroxy-6-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-2-yl]pentanoic acid |
| SMILES | COc1ccc(-c2cn3c(O)c(CCCCC(=O)O)nc3cn2)cc1 |
| InChI | InChI=1S/C18H19N3O4/c1-25-13-8-6-12(7-9-13)15-11-21-16(10-19-15)20-14(18(21)24)4-2-3-5-17(22)23/h6-11,24H,2-5H2,1H3,(H,22,23) |
| InChIKey | IUNNPHQUHADFGD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|