C20H26N4O2 — CID 136918359
6-[4-(4-aminobutoxy)phenyl]-2-tert-butylimidazo[1,2-a]pyrazin-3-ol (PubChem CID 136918359) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 6-[4-(4-aminobutoxy)phenyl]-2-tert-butylimidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 6-[4-(4-aminobutoxy)phenyl]-2-tert-butylimidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 136918359 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 6-[4-(4-aminobutoxy)phenyl]-2-tert-butylimidazo[1,2-a]pyrazin-3-ol |
| SMILES | CC(C)(C)c1nc2cnc(-c3ccc(OCCCCN)cc3)cn2c1O |
| InChI | InChI=1S/C20H26N4O2/c1-20(2,3)18-19(25)24-13-16(22-12-17(24)23-18)14-6-8-15(9-7-14)26-11-5-4-10-21/h6-9,12-13,25H,4-5,10-11,21H2,1-3H3 |
| InChIKey | PEFUHFONFFRMGV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|