C9H10Cl2F2O — CID 139626227
1,3-dichloro-1,3-bis(1-fluorocyclopropyl)propan-2-one (PubChem CID 139626227) has the molecular formula C9H10Cl2F2O and a molecular weight of 243.08 g/mol. Its IUPAC name is 1,3-dichloro-1,3-bis(1-fluorocyclopropyl)propan-2-one.
| Compound Name | 1,3-dichloro-1,3-bis(1-fluorocyclopropyl)propan-2-one |
|---|---|
| PubChem CID | 139626227 |
| Molecular Formula | C9H10Cl2F2O |
| Molecular Weight | 243.08 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 1,3-dichloro-1,3-bis(1-fluorocyclopropyl)propan-2-one |
| SMILES | O=C(C(Cl)C1(F)CC1)C(Cl)C1(F)CC1 |
| InChI | InChI=1S/C9H10Cl2F2O/c10-6(8(12)1-2-8)5(14)7(11)9(13)3-4-9/h6-7H,1-4H2 |
| InChIKey | XPPORINCYGMGBY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.08 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|