C25H31N3OS2 — CID 139627517
1-(4-aminophenyl)-2-methyl-3-[(2-sulfanylphenyl)methylamino]-2-[[(2-sulfanylphenyl)methylamino]methyl]propan-1-ol (PubChem CID 139627517) has the molecular formula C25H31N3OS2 and a molecular weight of 453.68 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-methyl-3-[(2-sulfanylphenyl)methylamino]-2-[[(2-sulfanylphenyl)methylamino]methyl]propan-1-ol.
| Compound Name | 1-(4-aminophenyl)-2-methyl-3-[(2-sulfanylphenyl)methylamino]-2-[[(2-sulfanylphenyl)methylamino]methyl]propan-1-ol |
|---|---|
| PubChem CID | 139627517 |
| Molecular Formula | C25H31N3OS2 |
| Molecular Weight | 453.68 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-(4-aminophenyl)-2-methyl-3-[(2-sulfanylphenyl)methylamino]-2-[[(2-sulfanylphenyl)methylamino]methyl]propan-1-ol |
| SMILES | CC(CNCc1ccccc1S)(CNCc1ccccc1S)C(O)c1ccc(N)cc1 |
| InChI | InChI=1S/C25H31N3OS2/c1-25(24(29)18-10-12-21(26)13-11-18,16-27-14-19-6-2-4-8-22(19)30)17-28-15-20-7-3-5-9-23(20)31/h2-13,24,27-31H,14-17,26H2,1H3 |
| InChIKey | ACARISIHFYIYAV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|