C16H19ClN4O3S — CID 139628608
2-[2-chloro-4-(6-sulfanylidene-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]-N-morpholin-4-ylacetamide (PubChem CID 139628608) has the molecular formula C16H19ClN4O3S and a molecular weight of 382.87 g/mol. Its IUPAC name is 2-[2-chloro-4-(6-sulfanylidene-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]-N-morpholin-4-ylacetamide.
| Compound Name | 2-[2-chloro-4-(6-sulfanylidene-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]-N-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 139628608 |
| Molecular Formula | C16H19ClN4O3S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2-[2-chloro-4-(6-sulfanylidene-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]-N-morpholin-4-ylacetamide |
| SMILES | O=C(COc1ccc(C2=NNC(=S)CC2)cc1Cl)NN1CCOCC1 |
| InChI | InChI=1S/C16H19ClN4O3S/c17-12-9-11(13-2-4-16(25)19-18-13)1-3-14(12)24-10-15(22)20-21-5-7-23-8-6-21/h1,3,9H,2,4-8,10H2,(H,19,25)(H,20,22) |
| InChIKey | ZPVQTWOMIIHPAG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|