C15H19ClN4O3 — CID 19905297
2-[2-chloro-4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]-N-propan-2-ylacetohydrazide (PubChem CID 19905297) has the molecular formula C15H19ClN4O3 and a molecular weight of 338.80 g/mol. Its IUPAC name is 2-[2-chloro-4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]-N-propan-2-ylacetohydrazide.
| Compound Name | 2-[2-chloro-4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]-N-propan-2-ylacetohydrazide |
|---|---|
| PubChem CID | 19905297 |
| Molecular Formula | C15H19ClN4O3 |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-[2-chloro-4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]-N-propan-2-ylacetohydrazide |
| SMILES | CC(C)N(N)C(=O)COc1ccc(C2=NNC(=O)CC2)cc1Cl |
| InChI | InChI=1S/C15H19ClN4O3/c1-9(2)20(17)15(22)8-23-13-5-3-10(7-11(13)16)12-4-6-14(21)19-18-12/h3,5,7,9H,4,6,8,17H2,1-2H3,(H,19,21) |
| InChIKey | XZPLKRVZPMATSF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|