C28H34ClN5O6 — CID 58833590
2-[2-chloro-4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]-N-[3-[4-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]-3-isocyanophenoxy]propyl]acetamide (PubChem CID 58833590) has the molecular formula C28H34ClN5O6 and a molecular weight of 572.06 g/mol. Its IUPAC name is 2-[2-chloro-4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]-N-[3-[4-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]-3-isocyanophenoxy]propyl]acetamide.
| Compound Name | 2-[2-chloro-4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]-N-[3-[4-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]-3-isocyanophenoxy]propyl]acetamide |
|---|---|
| PubChem CID | 58833590 |
| Molecular Formula | C28H34ClN5O6 |
| Molecular Weight | 572.06 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | 2-[2-chloro-4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]-N-[3-[4-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]-3-isocyanophenoxy]propyl]acetamide |
| SMILES | [C-]#[N+]c1cc(OCCCNC(=O)COc2ccc(C3=NNC(=O)CC3)cc2Cl)ccc1OC[C@@H](O)CNC(C)C |
| InChI | InChI=1S/C28H34ClN5O6/c1-18(2)32-15-20(35)16-39-26-9-6-21(14-24(26)30-3)38-12-4-11-31-28(37)17-40-25-8-5-19(13-22(25)29)23-7-10-27(36)34-33-23/h5-6,8-9,13-14,18,20,32,35H,4,7,10-12,15-17H2,1-2H3,(H,31,37)(H,34,36)/t20-/m0/s1 |
| InChIKey | ZSWGOSUKCPUPNU-FQEVSTJZSA-N |
| XLogP | 3.21 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.06 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|