C16H25N3O3 — CID 58833597
(2S)-1-[4-(3-aminopropoxy)-3-isocyanophenoxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 58833597) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is (2S)-1-[4-(3-aminopropoxy)-3-isocyanophenoxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | (2S)-1-[4-(3-aminopropoxy)-3-isocyanophenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 58833597 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (2S)-1-[4-(3-aminopropoxy)-3-isocyanophenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | [C-]#[N+]c1cc(OC[C@@H](O)CNC(C)C)ccc1OCCCN |
| InChI | InChI=1S/C16H25N3O3/c1-12(2)19-10-13(20)11-22-14-5-6-16(15(9-14)18-3)21-8-4-7-17/h5-6,9,12-13,19-20H,4,7-8,10-11,17H2,1-2H3/t13-/m0/s1 |
| InChIKey | PDUWJBWPTZHNCV-ZDUSSCGKSA-N |
| XLogP | 1.70 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|