C15H20ClN3O3 — CID 11602285
3-[3-chloro-4-[2-[[(2S)-2-hydroxypropyl]amino]ethoxy]phenyl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 11602285) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 3-[3-chloro-4-[2-[[(2S)-2-hydroxypropyl]amino]ethoxy]phenyl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[3-chloro-4-[2-[[(2S)-2-hydroxypropyl]amino]ethoxy]phenyl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 11602285 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 3-[3-chloro-4-[2-[[(2S)-2-hydroxypropyl]amino]ethoxy]phenyl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | C[C@H](O)CNCCOc1ccc(C2=NNC(=O)CC2)cc1Cl |
| InChI | InChI=1S/C15H20ClN3O3/c1-10(20)9-17-6-7-22-14-4-2-11(8-12(14)16)13-3-5-15(21)19-18-13/h2,4,8,10,17,20H,3,5-7,9H2,1H3,(H,19,21)/t10-/m0/s1 |
| InChIKey | XGMXAVQKGDUGPN-JTQLQIEISA-N |
| XLogP | 1.30 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|