C11H15BrClNO2 — CID 7375680
(2R)-1-[2-(4-bromo-2-chlorophenoxy)ethylamino]propan-2-ol (PubChem CID 7375680) has the molecular formula C11H15BrClNO2 and a molecular weight of 308.60 g/mol. Its IUPAC name is (2R)-1-[2-(4-bromo-2-chlorophenoxy)ethylamino]propan-2-ol.
| Compound Name | (2R)-1-[2-(4-bromo-2-chlorophenoxy)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 7375680 |
| Molecular Formula | C11H15BrClNO2 |
| Molecular Weight | 308.60 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | (2R)-1-[2-(4-bromo-2-chlorophenoxy)ethylamino]propan-2-ol |
| SMILES | C[C@@H](O)CNCCOc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C11H15BrClNO2/c1-8(15)7-14-4-5-16-11-3-2-9(12)6-10(11)13/h2-3,6,8,14-15H,4-5,7H2,1H3/t8-/m1/s1 |
| InChIKey | PYXZJKQJGPKKMC-MRVPVSSYSA-N |
| XLogP | 2.45 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|