C30H33ClN4O4 — CID 11678374
3-[4-[3-[[3-(9H-carbazol-4-yloxy)-2-hydroxypentyl]amino]propoxy]-3-chlorophenyl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 11678374) has the molecular formula C30H33ClN4O4 and a molecular weight of 549.07 g/mol. Its IUPAC name is 3-[4-[3-[[3-(9H-carbazol-4-yloxy)-2-hydroxypentyl]amino]propoxy]-3-chlorophenyl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[4-[3-[[3-(9H-carbazol-4-yloxy)-2-hydroxypentyl]amino]propoxy]-3-chlorophenyl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 11678374 |
| Molecular Formula | C30H33ClN4O4 |
| Molecular Weight | 549.07 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 3-[4-[3-[[3-(9H-carbazol-4-yloxy)-2-hydroxypentyl]amino]propoxy]-3-chlorophenyl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CCC(Oc1cccc2[nH]c3ccccc3c12)C(O)CNCCCOc1ccc(C2=NNC(=O)CC2)cc1Cl |
| InChI | InChI=1S/C30H33ClN4O4/c1-2-26(39-28-10-5-9-24-30(28)20-7-3-4-8-23(20)33-24)25(36)18-32-15-6-16-38-27-13-11-19(17-21(27)31)22-12-14-29(37)35-34-22/h3-5,7-11,13,17,25-26,32-33,36H,2,6,12,14-16,18H2,1H3,(H,35,37) |
| InChIKey | LSFSNENFVRUQPD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.07 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|