C29H31IN4O4 — CID 143236974
3-[4-[2-[[3-(3-anilinophenoxy)-2-hydroxypropyl]amino]ethoxy]-3-(1λ3-iodacyclopropen-2-yl)phenyl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 143236974) has the molecular formula C29H31IN4O4 and a molecular weight of 626.50 g/mol. Its IUPAC name is 3-[4-[2-[[3-(3-anilinophenoxy)-2-hydroxypropyl]amino]ethoxy]-3-(1λ3-iodacyclopropen-2-yl)phenyl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[4-[2-[[3-(3-anilinophenoxy)-2-hydroxypropyl]amino]ethoxy]-3-(1λ3-iodacyclopropen-2-yl)phenyl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 143236974 |
| Molecular Formula | C29H31IN4O4 |
| Molecular Weight | 626.50 g/mol |
| Exact Mass | 626.14 |
| IUPAC Name | 3-[4-[2-[[3-(3-anilinophenoxy)-2-hydroxypropyl]amino]ethoxy]-3-(1λ3-iodacyclopropen-2-yl)phenyl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | O=C1CCC(c2ccc(OCCNCC(O)COc3cccc(Nc4ccccc4)c3)c(C3=IC3)c2)=NN1 |
| InChI | InChI=1S/C29H31IN4O4/c35-23(19-38-24-8-4-7-22(16-24)32-21-5-2-1-3-6-21)18-31-13-14-37-28-11-9-20(15-25(28)26-17-30-26)27-10-12-29(36)34-33-27/h1-9,11,15-16,23,31-32,35H,10,12-14,17-19H2,(H,34,36) |
| InChIKey | SYTUSPCSDUJJTC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|