C26H29N3O4 — CID 15107830
3-[3-[2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]ethoxy]phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 15107830) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-[3-[2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]ethoxy]phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[3-[2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]ethoxy]phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 15107830 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 3-[3-[2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]ethoxy]phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CC1CC(=O)NN=C1c1cccc(OCCNCC(O)COc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C26H29N3O4/c1-18-14-25(31)28-29-26(18)20-8-4-9-22(15-20)32-13-12-27-16-21(30)17-33-24-11-5-7-19-6-2-3-10-23(19)24/h2-11,15,18,21,27,30H,12-14,16-17H2,1H3,(H,28,31) |
| InChIKey | SZONNAZUSYIZIP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|