C23H25ClN2O4 — CID 59706599
[4-[2-[2-chloro-4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]ethyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 59706599) has the molecular formula C23H25ClN2O4 and a molecular weight of 428.92 g/mol. Its IUPAC name is [4-[2-[2-chloro-4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]ethyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[2-[2-chloro-4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]ethyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59706599 |
| Molecular Formula | C23H25ClN2O4 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [4-[2-[2-chloro-4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]ethyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc(CCOc2ccc(C3=NNC(=O)CC3)cc2Cl)cc1 |
| InChI | InChI=1S/C23H25ClN2O4/c1-23(2,3)22(28)30-17-7-4-15(5-8-17)12-13-29-20-10-6-16(14-18(20)24)19-9-11-21(27)26-25-19/h4-8,10,14H,9,11-13H2,1-3H3,(H,26,27) |
| InChIKey | UTJZYDQEDDTZHQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|