C19H29N3O2 — CID 143236938
3-[4-(3-aminopropoxy)-3-(4-methylpentan-2-yl)phenyl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 143236938) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-[4-(3-aminopropoxy)-3-(4-methylpentan-2-yl)phenyl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[4-(3-aminopropoxy)-3-(4-methylpentan-2-yl)phenyl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 143236938 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 3-[4-(3-aminopropoxy)-3-(4-methylpentan-2-yl)phenyl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CC(C)CC(C)c1cc(C2=NNC(=O)CC2)ccc1OCCCN |
| InChI | InChI=1S/C19H29N3O2/c1-13(2)11-14(3)16-12-15(17-6-8-19(23)22-21-17)5-7-18(16)24-10-4-9-20/h5,7,12-14H,4,6,8-11,20H2,1-3H3,(H,22,23) |
| InChIKey | GURFXLJXNSVAQO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|