C28H30N2O3 — CID 139630395
N-[(1S)-1-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-N-methyl-9H-xanthene-9-carboxamide (PubChem CID 139630395) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-[(1S)-1-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-N-methyl-9H-xanthene-9-carboxamide.
| Compound Name | N-[(1S)-1-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-N-methyl-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 139630395 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | N-[(1S)-1-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-N-methyl-9H-xanthene-9-carboxamide |
| SMILES | COc1ccc([C@@H](CN2CCCC2)N(C)C(=O)C2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C28H30N2O3/c1-29(24(19-30-17-7-8-18-30)20-13-15-21(32-2)16-14-20)28(31)27-22-9-3-5-11-25(22)33-26-12-6-4-10-23(26)27/h3-6,9-16,24,27H,7-8,17-19H2,1-2H3/t24-/m1/s1 |
| InChIKey | MSLNVTGLZQGZER-XMMPIXPASA-N |
| XLogP | 5.23 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |