C27H28N2O2 — CID 67673330
N-methyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]-9H-xanthene-9-carboxamide (PubChem CID 67673330) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-methyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-methyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 67673330 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-methyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]-9H-xanthene-9-carboxamide |
| SMILES | CN(C(=O)C1c2ccccc2Oc2ccccc21)[C@H](CN1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O2/c1-28(23(19-29-17-9-10-18-29)20-11-3-2-4-12-20)27(30)26-21-13-5-7-15-24(21)31-25-16-8-6-14-22(25)26/h2-8,11-16,23,26H,9-10,17-19H2,1H3/t23-/m1/s1 |
| InChIKey | QLKKDAYUDGXYRC-HSZRJFAPSA-N |
| XLogP | 5.22 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |