C25H33N3O2S — CID 143014493
6-(dimethylaminosulfanyl)-N-methyl-N-(1-phenyl-2-pyrrolidin-1-ylethyl)-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 143014493) has the molecular formula C25H33N3O2S and a molecular weight of 439.63 g/mol. Its IUPAC name is 6-(dimethylaminosulfanyl)-N-methyl-N-(1-phenyl-2-pyrrolidin-1-ylethyl)-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | 6-(dimethylaminosulfanyl)-N-methyl-N-(1-phenyl-2-pyrrolidin-1-ylethyl)-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 143014493 |
| Molecular Formula | C25H33N3O2S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 6-(dimethylaminosulfanyl)-N-methyl-N-(1-phenyl-2-pyrrolidin-1-ylethyl)-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | CN(C)Sc1ccc2c(c1)CCC(C(=O)N(C)C(CN1CCCC1)c1ccccc1)O2 |
| InChI | InChI=1S/C25H33N3O2S/c1-26(2)31-21-12-14-23-20(17-21)11-13-24(30-23)25(29)27(3)22(18-28-15-7-8-16-28)19-9-5-4-6-10-19/h4-6,9-10,12,14,17,22,24H,7-8,11,13,15-16,18H2,1-3H3 |
| InChIKey | DMFGOLFXCMYCSQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|