C12H20O3 — CID 139630458
(4R,6E)-3,4-dihydroxy-2-methylundeca-2,6-dien-5-one (PubChem CID 139630458) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (4R,6E)-3,4-dihydroxy-2-methylundeca-2,6-dien-5-one.
| Compound Name | (4R,6E)-3,4-dihydroxy-2-methylundeca-2,6-dien-5-one |
|---|---|
| PubChem CID | 139630458 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (4R,6E)-3,4-dihydroxy-2-methylundeca-2,6-dien-5-one |
| SMILES | CCCC/C=C/C(=O)[C@H](O)C(O)=C(C)C |
| InChI | InChI=1S/C12H20O3/c1-4-5-6-7-8-10(13)12(15)11(14)9(2)3/h7-8,12,14-15H,4-6H2,1-3H3/b8-7+/t12-/m0/s1 |
| InChIKey | SLNISADTPMUTBX-GUOLPTJISA-N |
| XLogP | 2.51 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|