C11H16O3 — CID 10397780
(2E,6E)-6-ethoxy-5-hydroxynona-2,6,8-trien-4-one (PubChem CID 10397780) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2E,6E)-6-ethoxy-5-hydroxynona-2,6,8-trien-4-one.
| Compound Name | (2E,6E)-6-ethoxy-5-hydroxynona-2,6,8-trien-4-one |
|---|---|
| PubChem CID | 10397780 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (2E,6E)-6-ethoxy-5-hydroxynona-2,6,8-trien-4-one |
| SMILES | C=C/C=C(/OCC)C(O)C(=O)/C=C/C |
| InChI | InChI=1S/C11H16O3/c1-4-7-9(12)11(13)10(8-5-2)14-6-3/h4-5,7-8,11,13H,2,6H2,1,3H3/b7-4+,10-8+ |
| InChIKey | ZTCAEXDDBPQPHA-DAAQNPAKSA-N |
| XLogP | 1.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|