C7H8O4 — CID 141070402
5,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one (PubChem CID 141070402) has the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. Its IUPAC name is 5,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one.
| Compound Name | 5,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 141070402 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 5,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1=C(O)C(O)C(=O)C=C1 |
| InChI | InChI=1S/C7H8O4/c1-11-5-3-2-4(8)6(9)7(5)10/h2-3,6,9-10H,1H3 |
| InChIKey | IWUALICUTSSCIL-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |