C26H33NO4 — CID 139632964
2-[3-(3,5-ditert-butyl-4-methoxyphenyl)prop-2-enoyl-methylamino]benzoic acid (PubChem CID 139632964) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is 2-[3-(3,5-ditert-butyl-4-methoxyphenyl)prop-2-enoyl-methylamino]benzoic acid.
| Compound Name | 2-[3-(3,5-ditert-butyl-4-methoxyphenyl)prop-2-enoyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 139632964 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 2-[3-(3,5-ditert-butyl-4-methoxyphenyl)prop-2-enoyl-methylamino]benzoic acid |
| SMILES | COc1c(C(C)(C)C)cc(C=CC(=O)N(C)c2ccccc2C(=O)O)cc1C(C)(C)C |
| InChI | InChI=1S/C26H33NO4/c1-25(2,3)19-15-17(16-20(23(19)31-8)26(4,5)6)13-14-22(28)27(7)21-12-10-9-11-18(21)24(29)30/h9-16H,1-8H3,(H,29,30) |
| InChIKey | FEEQOISRVFLDEB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|