About [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride
[2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride (PubChem CID 139633052) has the molecular formula C12H20ClNO5
and a molecular weight of 293.75 g/mol. Its IUPAC name is [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride |
| PubChem CID | 139633052 |
| Molecular Formula | C12H20ClNO5 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride |
| SMILES | CC(C)(C)C(=O)OCOC(=O)CN1CCCC1=O.Cl |
| InChI | InChI=1S/C12H19NO5.ClH/c1-12(2,3)11(16)18-8-17-10(15)7-13-6-4-5-9(13)14;/h4-8H2,1-3H3;1H |
| InChIKey | AWGNVSUARBDNNK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride?
The IUPAC name of [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride (CID 139633052) is [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride.
What is the SMILES notation for [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride?
The canonical SMILES for [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride is CC(C)(C)C(=O)OCOC(=O)CN1CCCC1=O.Cl.
What is the InChIKey of [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride?
The InChIKey is AWGNVSUARBDNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO5.ClH/c1-12(2,3)11(16)18-8-17-10(15)7-13-6-4-5-9(13)14;/h4-8H2,1-3H3;1H.
What are the key properties of [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride?
[2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride has a molecular weight of 293.75 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-oxopyrrolidin-1-yl)acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride is sourced from PubChem (CID 139633052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).