C11H16ClNO3 — CID 75412929
[(E)-3-chloroprop-2-enyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 75412929) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is [(E)-3-chloroprop-2-enyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [(E)-3-chloroprop-2-enyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 75412929 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | [(E)-3-chloroprop-2-enyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | O=C(CN1CCCCCC1=O)OC/C=C/Cl |
| InChI | InChI=1S/C11H16ClNO3/c12-6-4-8-16-11(15)9-13-7-3-1-2-5-10(13)14/h4,6H,1-3,5,7-9H2/b6-4+ |
| InChIKey | HMTJQDVNIWVMHS-GQCTYLIASA-N |
| XLogP | 1.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |