C17H36Si2 — CID 139633925
(3-ethyl-6-methyl-8-trimethylsilylocta-2,6-dienyl)-trimethylsilane (PubChem CID 139633925) has the molecular formula C17H36Si2 and a molecular weight of 296.65 g/mol. Its IUPAC name is (3-ethyl-6-methyl-8-trimethylsilylocta-2,6-dienyl)-trimethylsilane.
| Compound Name | (3-ethyl-6-methyl-8-trimethylsilylocta-2,6-dienyl)-trimethylsilane |
|---|---|
| PubChem CID | 139633925 |
| Molecular Formula | C17H36Si2 |
| Molecular Weight | 296.65 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | (3-ethyl-6-methyl-8-trimethylsilylocta-2,6-dienyl)-trimethylsilane |
| SMILES | CCC(=CC[Si](C)(C)C)CCC(C)=CC[Si](C)(C)C |
| InChI | InChI=1S/C17H36Si2/c1-9-17(13-15-19(6,7)8)11-10-16(2)12-14-18(3,4)5/h12-13H,9-11,14-15H2,1-8H3 |
| InChIKey | RUNDPQCUKACGEN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|