C15H31FSi2 — CID 5371444
[(2E)-3,7-dimethyl-1-trimethylsilylocta-2,6-dienyl]-fluoro-dimethylsilane (PubChem CID 5371444) has the molecular formula C15H31FSi2 and a molecular weight of 286.58 g/mol. Its IUPAC name is [(2E)-3,7-dimethyl-1-trimethylsilylocta-2,6-dienyl]-fluoro-dimethylsilane.
| Compound Name | [(2E)-3,7-dimethyl-1-trimethylsilylocta-2,6-dienyl]-fluoro-dimethylsilane |
|---|---|
| PubChem CID | 5371444 |
| Molecular Formula | C15H31FSi2 |
| Molecular Weight | 286.58 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | [(2E)-3,7-dimethyl-1-trimethylsilylocta-2,6-dienyl]-fluoro-dimethylsilane |
| SMILES | CC(C)=CCC/C(C)=C/C([Si](C)(C)C)[Si](C)(C)F |
| InChI | InChI=1S/C15H31FSi2/c1-13(2)10-9-11-14(3)12-15(17(4,5)6)18(7,8)16/h10,12,15H,9,11H2,1-8H3/b14-12+ |
| InChIKey | GVHQBNYYRPHYFT-WYMLVPIESA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|