C12H27FSi2 — CID 5372458
[(E)-3,4-dimethyl-1-trimethylsilylpent-2-enyl]-fluoro-dimethylsilane (PubChem CID 5372458) has the molecular formula C12H27FSi2 and a molecular weight of 246.52 g/mol. Its IUPAC name is [(E)-3,4-dimethyl-1-trimethylsilylpent-2-enyl]-fluoro-dimethylsilane.
| Compound Name | [(E)-3,4-dimethyl-1-trimethylsilylpent-2-enyl]-fluoro-dimethylsilane |
|---|---|
| PubChem CID | 5372458 |
| Molecular Formula | C12H27FSi2 |
| Molecular Weight | 246.52 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | [(E)-3,4-dimethyl-1-trimethylsilylpent-2-enyl]-fluoro-dimethylsilane |
| SMILES | C/C(=C\C([Si](C)(C)C)[Si](C)(C)F)C(C)C |
| InChI | InChI=1S/C12H27FSi2/c1-10(2)11(3)9-12(14(4,5)6)15(7,8)13/h9-10,12H,1-8H3/b11-9+ |
| InChIKey | PKROQAAURWAEEK-PKNBQFBNSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|