C14H28Si2 — CID 552974
(3,6-dimethyl-2-trimethylsilylcyclohexa-1,4-dien-1-yl)-trimethylsilane (PubChem CID 552974) has the molecular formula C14H28Si2 and a molecular weight of 252.55 g/mol. Its IUPAC name is (3,6-dimethyl-2-trimethylsilylcyclohexa-1,4-dien-1-yl)-trimethylsilane.
| Compound Name | (3,6-dimethyl-2-trimethylsilylcyclohexa-1,4-dien-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 552974 |
| Molecular Formula | C14H28Si2 |
| Molecular Weight | 252.55 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3,6-dimethyl-2-trimethylsilylcyclohexa-1,4-dien-1-yl)-trimethylsilane |
| SMILES | CC1C=CC(C)C([Si](C)(C)C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C14H28Si2/c1-11-9-10-12(2)14(16(6,7)8)13(11)15(3,4)5/h9-12H,1-8H3 |
| InChIKey | IIPCDSBUWALMEX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|