C13H26Si2 — CID 553171
trimethyl-(4-methyl-2-trimethylsilylcyclohexa-1,4-dien-1-yl)silane (PubChem CID 553171) has the molecular formula C13H26Si2 and a molecular weight of 238.52 g/mol. Its IUPAC name is trimethyl-(4-methyl-2-trimethylsilylcyclohexa-1,4-dien-1-yl)silane.
| Compound Name | trimethyl-(4-methyl-2-trimethylsilylcyclohexa-1,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 553171 |
| Molecular Formula | C13H26Si2 |
| Molecular Weight | 238.52 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | trimethyl-(4-methyl-2-trimethylsilylcyclohexa-1,4-dien-1-yl)silane |
| SMILES | CC1=CCC([Si](C)(C)C)=C([Si](C)(C)C)C1 |
| InChI | InChI=1S/C13H26Si2/c1-11-8-9-12(14(2,3)4)13(10-11)15(5,6)7/h8H,9-10H2,1-7H3 |
| InChIKey | SBJOPQPPNUZVNX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|