C16H36Si2 — CID 5366709
tert-butyl-[(E)-3,4-dimethyl-1-trimethylsilylpent-2-enyl]-dimethylsilane (PubChem CID 5366709) has the molecular formula C16H36Si2 and a molecular weight of 284.64 g/mol. Its IUPAC name is tert-butyl-[(E)-3,4-dimethyl-1-trimethylsilylpent-2-enyl]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-3,4-dimethyl-1-trimethylsilylpent-2-enyl]-dimethylsilane |
|---|---|
| PubChem CID | 5366709 |
| Molecular Formula | C16H36Si2 |
| Molecular Weight | 284.64 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | tert-butyl-[(E)-3,4-dimethyl-1-trimethylsilylpent-2-enyl]-dimethylsilane |
| SMILES | C/C(=C\C([Si](C)(C)C)[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H36Si2/c1-13(2)14(3)12-15(17(7,8)9)18(10,11)16(4,5)6/h12-13,15H,1-11H3/b14-12+ |
| InChIKey | WNEQSZVTEWEYBB-WYMLVPIESA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|