C21H29N3O5 — CID 139634541
N-[[4-(2-cyanoethylcarbamoyl)cyclohexyl]methyl]-2,4,5-trimethoxybenzamide (PubChem CID 139634541) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is N-[[4-(2-cyanoethylcarbamoyl)cyclohexyl]methyl]-2,4,5-trimethoxybenzamide.
| Compound Name | N-[[4-(2-cyanoethylcarbamoyl)cyclohexyl]methyl]-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 139634541 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-[[4-(2-cyanoethylcarbamoyl)cyclohexyl]methyl]-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)NCC2CCC(C(=O)NCCC#N)CC2)cc1OC |
| InChI | InChI=1S/C21H29N3O5/c1-27-17-12-19(29-3)18(28-2)11-16(17)21(26)24-13-14-5-7-15(8-6-14)20(25)23-10-4-9-22/h11-12,14-15H,4-8,10,13H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | SSXJEIGNVYZKCP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|