C14H18FNO2 — CID 139635170
ethyl N-[(1R,2S)-2-fluorocyclopropyl]-N-(1-phenylethyl)carbamate (PubChem CID 139635170) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is ethyl N-[(1R,2S)-2-fluorocyclopropyl]-N-(1-phenylethyl)carbamate.
| Compound Name | ethyl N-[(1R,2S)-2-fluorocyclopropyl]-N-(1-phenylethyl)carbamate |
|---|---|
| PubChem CID | 139635170 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | ethyl N-[(1R,2S)-2-fluorocyclopropyl]-N-(1-phenylethyl)carbamate |
| SMILES | CCOC(=O)N(C(C)c1ccccc1)[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C14H18FNO2/c1-3-18-14(17)16(13-9-12(13)15)10(2)11-7-5-4-6-8-11/h4-8,10,12-13H,3,9H2,1-2H3/t10?,12-,13+/m0/s1 |
| InChIKey | VBKQMVCGVRFZSN-HEVMSJOKSA-N |
| XLogP | 3.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |