C20H18O — CID 139636207
1-buta-1,3-diynyl-4-[3-(2-methylpropoxy)phenyl]benzene (PubChem CID 139636207) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-buta-1,3-diynyl-4-[3-(2-methylpropoxy)phenyl]benzene.
| Compound Name | 1-buta-1,3-diynyl-4-[3-(2-methylpropoxy)phenyl]benzene |
|---|---|
| PubChem CID | 139636207 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-buta-1,3-diynyl-4-[3-(2-methylpropoxy)phenyl]benzene |
| SMILES | C#CC#Cc1ccc(-c2cccc(OCC(C)C)c2)cc1 |
| InChI | InChI=1S/C20H18O/c1-4-5-7-17-10-12-18(13-11-17)19-8-6-9-20(14-19)21-15-16(2)3/h1,6,8-14,16H,15H2,2-3H3 |
| InChIKey | KLQCMZIJRGCNOM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|