C22H29NO4 — CID 139636788
(2E)-4-(8-azaspiro[4.5]decan-8-yl)-2-[(2-ethoxyphenyl)methylidene]-4-oxobutanoic acid (PubChem CID 139636788) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2E)-4-(8-azaspiro[4.5]decan-8-yl)-2-[(2-ethoxyphenyl)methylidene]-4-oxobutanoic acid.
| Compound Name | (2E)-4-(8-azaspiro[4.5]decan-8-yl)-2-[(2-ethoxyphenyl)methylidene]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139636788 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (2E)-4-(8-azaspiro[4.5]decan-8-yl)-2-[(2-ethoxyphenyl)methylidene]-4-oxobutanoic acid |
| SMILES | CCOc1ccccc1/C=C(\CC(=O)N1CCC2(CCCC2)CC1)C(=O)O |
| InChI | InChI=1S/C22H29NO4/c1-2-27-19-8-4-3-7-17(19)15-18(21(25)26)16-20(24)23-13-11-22(12-14-23)9-5-6-10-22/h3-4,7-8,15H,2,5-6,9-14,16H2,1H3,(H,25,26)/b18-15+ |
| InChIKey | JVDXHNUUQVHGBX-OBGWFSINSA-N |
| XLogP | 4.13 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|