C22H29NO3 — CID 139636802
(2E)-4-(3-azaspiro[5.5]undecan-3-yl)-2-[(2-methylphenyl)methylidene]-4-oxobutanoic acid (PubChem CID 139636802) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (2E)-4-(3-azaspiro[5.5]undecan-3-yl)-2-[(2-methylphenyl)methylidene]-4-oxobutanoic acid.
| Compound Name | (2E)-4-(3-azaspiro[5.5]undecan-3-yl)-2-[(2-methylphenyl)methylidene]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139636802 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (2E)-4-(3-azaspiro[5.5]undecan-3-yl)-2-[(2-methylphenyl)methylidene]-4-oxobutanoic acid |
| SMILES | Cc1ccccc1/C=C(\CC(=O)N1CCC2(CCCCC2)CC1)C(=O)O |
| InChI | InChI=1S/C22H29NO3/c1-17-7-3-4-8-18(17)15-19(21(25)26)16-20(24)23-13-11-22(12-14-23)9-5-2-6-10-22/h3-4,7-8,15H,2,5-6,9-14,16H2,1H3,(H,25,26)/b19-15+ |
| InChIKey | BNQSXCWUDLEBNJ-XDJHFCHBSA-N |
| XLogP | 4.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|