C24H33NO3 — CID 139636794
(2E)-4-(3-azaspiro[5.5]undecan-3-yl)-4-oxo-2-[(2-propan-2-ylphenyl)methylidene]butanoic acid (PubChem CID 139636794) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is (2E)-4-(3-azaspiro[5.5]undecan-3-yl)-4-oxo-2-[(2-propan-2-ylphenyl)methylidene]butanoic acid.
| Compound Name | (2E)-4-(3-azaspiro[5.5]undecan-3-yl)-4-oxo-2-[(2-propan-2-ylphenyl)methylidene]butanoic acid |
|---|---|
| PubChem CID | 139636794 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | (2E)-4-(3-azaspiro[5.5]undecan-3-yl)-4-oxo-2-[(2-propan-2-ylphenyl)methylidene]butanoic acid |
| SMILES | CC(C)c1ccccc1/C=C(\CC(=O)N1CCC2(CCCCC2)CC1)C(=O)O |
| InChI | InChI=1S/C24H33NO3/c1-18(2)21-9-5-4-8-19(21)16-20(23(27)28)17-22(26)25-14-12-24(13-15-25)10-6-3-7-11-24/h4-5,8-9,16,18H,3,6-7,10-15,17H2,1-2H3,(H,27,28)/b20-16+ |
| InChIKey | FAWOILTUQCWHAS-CAPFRKAQSA-N |
| XLogP | 5.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|