C29H44N2O2 — CID 139636810
3-(2-hexyldecyl)-5-(3-phenylbut-2-enylidene)imidazolidine-2,4-dione (PubChem CID 139636810) has the molecular formula C29H44N2O2 and a molecular weight of 452.68 g/mol. Its IUPAC name is 3-(2-hexyldecyl)-5-(3-phenylbut-2-enylidene)imidazolidine-2,4-dione.
| Compound Name | 3-(2-hexyldecyl)-5-(3-phenylbut-2-enylidene)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139636810 |
| Molecular Formula | C29H44N2O2 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | 3-(2-hexyldecyl)-5-(3-phenylbut-2-enylidene)imidazolidine-2,4-dione |
| SMILES | CCCCCCCCC(CCCCCC)CN1C(=O)NC(=CC=C(C)c2ccccc2)C1=O |
| InChI | InChI=1S/C29H44N2O2/c1-4-6-8-10-11-14-18-25(17-13-9-7-5-2)23-31-28(32)27(30-29(31)33)22-21-24(3)26-19-15-12-16-20-26/h12,15-16,19-22,25H,4-11,13-14,17-18,23H2,1-3H3,(H,30,33) |
| InChIKey | QMXLLWIUBOAUIV-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|