C13H13ClO — CID 139637423
2-(4-methylphenyl)cyclopent-3-ene-1-carbonyl chloride (PubChem CID 139637423) has the molecular formula C13H13ClO and a molecular weight of 220.70 g/mol. Its IUPAC name is 2-(4-methylphenyl)cyclopent-3-ene-1-carbonyl chloride.
| Compound Name | 2-(4-methylphenyl)cyclopent-3-ene-1-carbonyl chloride |
|---|---|
| PubChem CID | 139637423 |
| Molecular Formula | C13H13ClO |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-(4-methylphenyl)cyclopent-3-ene-1-carbonyl chloride |
| SMILES | Cc1ccc(C2C=CCC2C(=O)Cl)cc1 |
| InChI | InChI=1S/C13H13ClO/c1-9-5-7-10(8-6-9)11-3-2-4-12(11)13(14)15/h2-3,5-8,11-12H,4H2,1H3 |
| InChIKey | BMZOIGFAZSJVKS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|