C14H14O2 — CID 154129475
6-(4-methylphenyl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 154129475) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 6-(4-methylphenyl)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-(4-methylphenyl)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 154129475 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 6-(4-methylphenyl)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | Cc1ccc(C2C=CC=CC2C(=O)O)cc1 |
| InChI | InChI=1S/C14H14O2/c1-10-6-8-11(9-7-10)12-4-2-3-5-13(12)14(15)16/h2-9,12-13H,1H3,(H,15,16) |
| InChIKey | AWGKSYUGXAPGBW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |