C32H51N5O4 — CID 139639021
N-[4-[4-[4-[2,6-dioxo-1,3-di(propan-2-yl)pyrimidin-4-yl]piperazin-1-yl]-2-methylbutan-2-yl]oxyphenyl]heptanamide (PubChem CID 139639021) has the molecular formula C32H51N5O4 and a molecular weight of 569.79 g/mol. Its IUPAC name is N-[4-[4-[4-[2,6-dioxo-1,3-di(propan-2-yl)pyrimidin-4-yl]piperazin-1-yl]-2-methylbutan-2-yl]oxyphenyl]heptanamide.
| Compound Name | N-[4-[4-[4-[2,6-dioxo-1,3-di(propan-2-yl)pyrimidin-4-yl]piperazin-1-yl]-2-methylbutan-2-yl]oxyphenyl]heptanamide |
|---|---|
| PubChem CID | 139639021 |
| Molecular Formula | C32H51N5O4 |
| Molecular Weight | 569.79 g/mol |
| Exact Mass | 569.39 |
| IUPAC Name | N-[4-[4-[4-[2,6-dioxo-1,3-di(propan-2-yl)pyrimidin-4-yl]piperazin-1-yl]-2-methylbutan-2-yl]oxyphenyl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1ccc(OC(C)(C)CCN2CCN(c3cc(=O)n(C(C)C)c(=O)n3C(C)C)CC2)cc1 |
| InChI | InChI=1S/C32H51N5O4/c1-8-9-10-11-12-28(38)33-26-13-15-27(16-14-26)41-32(6,7)17-18-34-19-21-35(22-20-34)29-23-30(39)37(25(4)5)31(40)36(29)24(2)3/h13-16,23-25H,8-12,17-22H2,1-7H3,(H,33,38) |
| InChIKey | UOJRJXILFYUXRS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 88.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.79 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|