C20H35N3O2S — CID 139638761
N-[4-(2-methyl-4-piperazin-1-ylbutan-2-yl)oxyphenyl]pentane-1-sulfinamide (PubChem CID 139638761) has the molecular formula C20H35N3O2S and a molecular weight of 381.59 g/mol. Its IUPAC name is N-[4-(2-methyl-4-piperazin-1-ylbutan-2-yl)oxyphenyl]pentane-1-sulfinamide.
| Compound Name | N-[4-(2-methyl-4-piperazin-1-ylbutan-2-yl)oxyphenyl]pentane-1-sulfinamide |
|---|---|
| PubChem CID | 139638761 |
| Molecular Formula | C20H35N3O2S |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | N-[4-(2-methyl-4-piperazin-1-ylbutan-2-yl)oxyphenyl]pentane-1-sulfinamide |
| SMILES | CCCCCS(=O)Nc1ccc(OC(C)(C)CCN2CCNCC2)cc1 |
| InChI | InChI=1S/C20H35N3O2S/c1-4-5-6-17-26(24)22-18-7-9-19(10-8-18)25-20(2,3)11-14-23-15-12-21-13-16-23/h7-10,21-22H,4-6,11-17H2,1-3H3 |
| InChIKey | PMRSBIKSGLTWMP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|