C20H34N2O3S — CID 139638935
3-methyl-3-(4-pentylsulfinylphenoxy)-1-piperazin-1-ylbutan-2-ol (PubChem CID 139638935) has the molecular formula C20H34N2O3S and a molecular weight of 382.57 g/mol. Its IUPAC name is 3-methyl-3-(4-pentylsulfinylphenoxy)-1-piperazin-1-ylbutan-2-ol.
| Compound Name | 3-methyl-3-(4-pentylsulfinylphenoxy)-1-piperazin-1-ylbutan-2-ol |
|---|---|
| PubChem CID | 139638935 |
| Molecular Formula | C20H34N2O3S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 3-methyl-3-(4-pentylsulfinylphenoxy)-1-piperazin-1-ylbutan-2-ol |
| SMILES | CCCCCS(=O)c1ccc(OC(C)(C)C(O)CN2CCNCC2)cc1 |
| InChI | InChI=1S/C20H34N2O3S/c1-4-5-6-15-26(24)18-9-7-17(8-10-18)25-20(2,3)19(23)16-22-13-11-21-12-14-22/h7-10,19,21,23H,4-6,11-16H2,1-3H3 |
| InChIKey | GYWFQSIHEWAYBB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|