C16H26N2O4S — CID 139638744
methyl 4-(3-hydroxy-2-methyl-4-piperazin-1-ylbutan-2-yl)oxybenzenesulfinate (PubChem CID 139638744) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is methyl 4-(3-hydroxy-2-methyl-4-piperazin-1-ylbutan-2-yl)oxybenzenesulfinate.
| Compound Name | methyl 4-(3-hydroxy-2-methyl-4-piperazin-1-ylbutan-2-yl)oxybenzenesulfinate |
|---|---|
| PubChem CID | 139638744 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | methyl 4-(3-hydroxy-2-methyl-4-piperazin-1-ylbutan-2-yl)oxybenzenesulfinate |
| SMILES | COS(=O)c1ccc(OC(C)(C)C(O)CN2CCNCC2)cc1 |
| InChI | InChI=1S/C16H26N2O4S/c1-16(2,15(19)12-18-10-8-17-9-11-18)22-13-4-6-14(7-5-13)23(20)21-3/h4-7,15,17,19H,8-12H2,1-3H3 |
| InChIKey | IKMPEAQNDJNVRM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |