C19H33N3O3S — CID 139639253
N-tert-butyl-4-(3-hydroxy-2-methyl-4-piperazin-1-ylbutan-2-yl)oxybenzenesulfinamide (PubChem CID 139639253) has the molecular formula C19H33N3O3S and a molecular weight of 383.56 g/mol. Its IUPAC name is N-tert-butyl-4-(3-hydroxy-2-methyl-4-piperazin-1-ylbutan-2-yl)oxybenzenesulfinamide.
| Compound Name | N-tert-butyl-4-(3-hydroxy-2-methyl-4-piperazin-1-ylbutan-2-yl)oxybenzenesulfinamide |
|---|---|
| PubChem CID | 139639253 |
| Molecular Formula | C19H33N3O3S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-tert-butyl-4-(3-hydroxy-2-methyl-4-piperazin-1-ylbutan-2-yl)oxybenzenesulfinamide |
| SMILES | CC(C)(C)NS(=O)c1ccc(OC(C)(C)C(O)CN2CCNCC2)cc1 |
| InChI | InChI=1S/C19H33N3O3S/c1-18(2,3)21-26(24)16-8-6-15(7-9-16)25-19(4,5)17(23)14-22-12-10-20-11-13-22/h6-9,17,20-21,23H,10-14H2,1-5H3 |
| InChIKey | WXJWPTKYKMPWLR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |