C15H23N3O4 — CID 139638534
3-methyl-3-(4-nitrophenoxy)-1-piperazin-1-ylbutan-2-ol (PubChem CID 139638534) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-methyl-3-(4-nitrophenoxy)-1-piperazin-1-ylbutan-2-ol.
| Compound Name | 3-methyl-3-(4-nitrophenoxy)-1-piperazin-1-ylbutan-2-ol |
|---|---|
| PubChem CID | 139638534 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 3-methyl-3-(4-nitrophenoxy)-1-piperazin-1-ylbutan-2-ol |
| SMILES | CC(C)(Oc1ccc([N+](=O)[O-])cc1)C(O)CN1CCNCC1 |
| InChI | InChI=1S/C15H23N3O4/c1-15(2,14(19)11-17-9-7-16-8-10-17)22-13-5-3-12(4-6-13)18(20)21/h3-6,14,16,19H,7-11H2,1-2H3 |
| InChIKey | MIUKACNCPYBTTA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|